C22H22ClF3N4O3 — CID 5300233
3-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]amino]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 5300233) has the molecular formula C22H22ClF3N4O3 and a molecular weight of 482.89 g/mol. Its IUPAC name is 3-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]amino]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]amino]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5300233 |
| Molecular Formula | C22H22ClF3N4O3 |
| Molecular Weight | 482.89 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 3-[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]amino]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cccc(N2C(=O)CC(NC3CCN(c4ncc(C(F)(F)F)cc4Cl)CC3)C2=O)c1 |
| InChI | InChI=1S/C22H22ClF3N4O3/c1-33-16-4-2-3-15(10-16)30-19(31)11-18(21(30)32)28-14-5-7-29(8-6-14)20-17(23)9-13(12-27-20)22(24,25)26/h2-4,9-10,12,14,18,28H,5-8,11H2,1H3 |
| InChIKey | DKRDYRWFZXUQFQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.89 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|