C24H19F3N6OS — CID 5300671
2-amino-5-oxo-4-[4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]-1-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 5300671) has the molecular formula C24H19F3N6OS and a molecular weight of 496.52 g/mol. Its IUPAC name is 2-amino-5-oxo-4-[4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]-1-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-5-oxo-4-[4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]-1-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5300671 |
| Molecular Formula | C24H19F3N6OS |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 2-amino-5-oxo-4-[4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]-1-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#CC1=C(N)N(c2ccccc2C(F)(F)F)C2=C(C(=O)CCC2)C1c1cc(Cn2cncn2)cs1 |
| InChI | InChI=1S/C24H19F3N6OS/c25-24(26,27)16-4-1-2-5-17(16)33-18-6-3-7-19(34)22(18)21(15(9-28)23(33)29)20-8-14(11-35-20)10-32-13-30-12-31-32/h1-2,4-5,8,11-13,21H,3,6-7,10,29H2 |
| InChIKey | ROVZOLFZMWZQII-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |