C13H15FN2O2 — CID 53017138
N-[(3,5-dimethyl-4H-1,2-oxazol-5-yl)methyl]-4-fluorobenzamide (PubChem CID 53017138) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is N-[(3,5-dimethyl-4H-1,2-oxazol-5-yl)methyl]-4-fluorobenzamide.
| Compound Name | N-[(3,5-dimethyl-4H-1,2-oxazol-5-yl)methyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 53017138 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-[(3,5-dimethyl-4H-1,2-oxazol-5-yl)methyl]-4-fluorobenzamide |
| SMILES | CC1=NOC(C)(CNC(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C13H15FN2O2/c1-9-7-13(2,18-16-9)8-15-12(17)10-3-5-11(14)6-4-10/h3-6H,7-8H2,1-2H3,(H,15,17) |
| InChIKey | CESRZQHHMLZTSM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |