C20H21N5O5S — CID 53019629
2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 53019629) has the molecular formula C20H21N5O5S and a molecular weight of 443.49 g/mol. Its IUPAC name is 2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 53019629 |
| Molecular Formula | C20H21N5O5S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)Cn2c(C)cc3nc4sc(C)nn4c(=O)c32)cc(OC)c1OC |
| InChI | InChI=1S/C20H21N5O5S/c1-10-6-13-17(19(27)25-20(22-13)31-11(2)23-25)24(10)9-16(26)21-12-7-14(28-3)18(30-5)15(8-12)29-4/h6-8H,9H2,1-5H3,(H,21,26) |
| InChIKey | HOUPUUBDIMKCBS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |