C15H19N5O2S — CID 46860784
2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)-N,N-diethylacetamide (PubChem CID 46860784) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is 2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)-N,N-diethylacetamide.
| Compound Name | 2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 46860784 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cn1c(C)cc2nc3sc(C)nn3c(=O)c21 |
| InChI | InChI=1S/C15H19N5O2S/c1-5-18(6-2)12(21)8-19-9(3)7-11-13(19)14(22)20-15(16-11)23-10(4)17-20/h7H,5-6,8H2,1-4H3 |
| InChIKey | LBXIMORJRAACNK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |