C18H17N5O2S — CID 53019616
2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)-N-(3-methylphenyl)acetamide (PubChem CID 53019616) has the molecular formula C18H17N5O2S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)-N-(3-methylphenyl)acetamide.
| Compound Name | 2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 53019616 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cn2c(C)cc3nc4sc(C)nn4c(=O)c32)c1 |
| InChI | InChI=1S/C18H17N5O2S/c1-10-5-4-6-13(7-10)19-15(24)9-22-11(2)8-14-16(22)17(25)23-18(20-14)26-12(3)21-23/h4-8H,9H2,1-3H3,(H,19,24) |
| InChIKey | MGCFZFBAUOZQQV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |