C17H13ClFN5O2S — CID 53019645
N-(2-chloro-4-fluorophenyl)-2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)acetamide (PubChem CID 53019645) has the molecular formula C17H13ClFN5O2S and a molecular weight of 405.84 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)acetamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)acetamide |
|---|---|
| PubChem CID | 53019645 |
| Molecular Formula | C17H13ClFN5O2S |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-(5,11-dimethyl-2-oxo-10-thia-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-4-yl)acetamide |
| SMILES | Cc1nn2c(=O)c3c(cc(C)n3CC(=O)Nc3ccc(F)cc3Cl)nc2s1 |
| InChI | InChI=1S/C17H13ClFN5O2S/c1-8-5-13-15(16(26)24-17(21-13)27-9(2)22-24)23(8)7-14(25)20-12-4-3-10(19)6-11(12)18/h3-6H,7H2,1-2H3,(H,20,25) |
| InChIKey | QTCMOAUIBLEVFY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |