C22H20N4O4 — CID 53022148
3-(1,3-benzodioxol-5-yl)-5-[3-(4-butoxyphenyl)-1H-pyrazol-5-yl]-1,2,4-oxadiazole (PubChem CID 53022148) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-[3-(4-butoxyphenyl)-1H-pyrazol-5-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-[3-(4-butoxyphenyl)-1H-pyrazol-5-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 53022148 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-[3-(4-butoxyphenyl)-1H-pyrazol-5-yl]-1,2,4-oxadiazole |
| SMILES | CCCCOc1ccc(-c2cc(-c3nc(-c4ccc5c(c4)OCO5)no3)[nH]n2)cc1 |
| InChI | InChI=1S/C22H20N4O4/c1-2-3-10-27-16-7-4-14(5-8-16)17-12-18(25-24-17)22-23-21(26-30-22)15-6-9-19-20(11-15)29-13-28-19/h4-9,11-12H,2-3,10,13H2,1H3,(H,24,25) |
| InChIKey | IDXCEHHYRVFOBO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|