C17H18ClN3O5S — CID 53024849
5-[(3-chloro-2-methylphenyl)sulfonylamino]-2-morpholin-4-ylpyridine-3-carboxylic acid (PubChem CID 53024849) has the molecular formula C17H18ClN3O5S and a molecular weight of 411.87 g/mol. Its IUPAC name is 5-[(3-chloro-2-methylphenyl)sulfonylamino]-2-morpholin-4-ylpyridine-3-carboxylic acid.
| Compound Name | 5-[(3-chloro-2-methylphenyl)sulfonylamino]-2-morpholin-4-ylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53024849 |
| Molecular Formula | C17H18ClN3O5S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 5-[(3-chloro-2-methylphenyl)sulfonylamino]-2-morpholin-4-ylpyridine-3-carboxylic acid |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)Nc1cnc(N2CCOCC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H18ClN3O5S/c1-11-14(18)3-2-4-15(11)27(24,25)20-12-9-13(17(22)23)16(19-10-12)21-5-7-26-8-6-21/h2-4,9-10,20H,5-8H2,1H3,(H,22,23) |
| InChIKey | AQHCVSKCFPJDKR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |