C25H24ClN3O2S — CID 5302645
5-chloro-4,6-dimethyl-3-[[(E)-3-phenylprop-2-enoyl]amino]-N,N-bis(prop-2-enyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 5302645) has the molecular formula C25H24ClN3O2S and a molecular weight of 466.01 g/mol. Its IUPAC name is 5-chloro-4,6-dimethyl-3-[[(E)-3-phenylprop-2-enoyl]amino]-N,N-bis(prop-2-enyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 5-chloro-4,6-dimethyl-3-[[(E)-3-phenylprop-2-enoyl]amino]-N,N-bis(prop-2-enyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 5302645 |
| Molecular Formula | C25H24ClN3O2S |
| Molecular Weight | 466.01 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 5-chloro-4,6-dimethyl-3-[[(E)-3-phenylprop-2-enoyl]amino]-N,N-bis(prop-2-enyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1sc2nc(C)c(Cl)c(C)c2c1NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C25H24ClN3O2S/c1-5-14-29(15-6-2)25(31)23-22(20-16(3)21(26)17(4)27-24(20)32-23)28-19(30)13-12-18-10-8-7-9-11-18/h5-13H,1-2,14-15H2,3-4H3,(H,28,30)/b13-12+ |
| InChIKey | KHACAJFNDIZGKX-OUKQBFOZSA-N |
| XLogP | 6.03 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.01 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|