C16H22N4O2 — CID 53029159
1-(4-methoxyphenyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea (PubChem CID 53029159) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 53029159 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea |
| SMILES | COc1ccc(NC(=O)NCCc2c(C)nn(C)c2C)cc1 |
| InChI | InChI=1S/C16H22N4O2/c1-11-15(12(2)20(3)19-11)9-10-17-16(21)18-13-5-7-14(22-4)8-6-13/h5-8H,9-10H2,1-4H3,(H2,17,18,21) |
| InChIKey | VQNTVWBARMZFJM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |