C19H22N4S — CID 71940899
1-naphthalen-2-yl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiourea (PubChem CID 71940899) has the molecular formula C19H22N4S and a molecular weight of 338.48 g/mol. Its IUPAC name is 1-naphthalen-2-yl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiourea.
| Compound Name | 1-naphthalen-2-yl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 71940899 |
| Molecular Formula | C19H22N4S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-naphthalen-2-yl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiourea |
| SMILES | Cc1nn(C)c(C)c1CCNC(=S)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H22N4S/c1-13-18(14(2)23(3)22-13)10-11-20-19(24)21-17-9-8-15-6-4-5-7-16(15)12-17/h4-9,12H,10-11H2,1-3H3,(H2,20,21,24) |
| InChIKey | XVMNVGOWGSJMPE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|