C33H34N2O3 — CID 5302994
2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-N-[2-(2-phenylethylcarbamoyl)phenyl]benzamide (PubChem CID 5302994) has the molecular formula C33H34N2O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-N-[2-(2-phenylethylcarbamoyl)phenyl]benzamide.
| Compound Name | 2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-N-[2-(2-phenylethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 5302994 |
| Molecular Formula | C33H34N2O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-N-[2-(2-phenylethylcarbamoyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(C)C)c(OCc2ccccc2C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C33H34N2O3/c1-23(2)27-18-17-24(3)21-31(27)38-22-26-13-7-8-14-28(26)33(37)35-30-16-10-9-15-29(30)32(36)34-20-19-25-11-5-4-6-12-25/h4-18,21,23H,19-20,22H2,1-3H3,(H,34,36)(H,35,37) |
| InChIKey | BXPCUESKWANCBN-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |