C28H35N5O3 — CID 53031548
4-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]-N-[2-(4-ethylpiperazin-1-yl)ethyl]benzamide (PubChem CID 53031548) has the molecular formula C28H35N5O3 and a molecular weight of 489.62 g/mol. Its IUPAC name is 4-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]-N-[2-(4-ethylpiperazin-1-yl)ethyl]benzamide.
| Compound Name | 4-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]-N-[2-(4-ethylpiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 53031548 |
| Molecular Formula | C28H35N5O3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 4-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]-N-[2-(4-ethylpiperazin-1-yl)ethyl]benzamide |
| SMILES | CCN1CCN(CCNC(=O)c2ccc(CN3C(=O)C4CCCN4C(=O)c4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C28H35N5O3/c1-2-30-16-18-31(19-17-30)15-13-29-26(34)22-11-9-21(10-12-22)20-33-24-7-4-3-6-23(24)27(35)32-14-5-8-25(32)28(33)36/h3-4,6-7,9-12,25H,2,5,8,13-20H2,1H3,(H,29,34) |
| InChIKey | GEYVAKGMDZHNPO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |