C30H32N4O3 — CID 93062041
4-[[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[2-[benzyl(methyl)amino]ethyl]benzamide (PubChem CID 93062041) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is 4-[[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[2-[benzyl(methyl)amino]ethyl]benzamide.
| Compound Name | 4-[[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[2-[benzyl(methyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 93062041 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 4-[[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[2-[benzyl(methyl)amino]ethyl]benzamide |
| SMILES | CN(CCNC(=O)c1ccc(CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H32N4O3/c1-32(20-22-8-3-2-4-9-22)19-17-31-28(35)24-15-13-23(14-16-24)21-34-26-11-6-5-10-25(26)29(36)33-18-7-12-27(33)30(34)37/h2-6,8-11,13-16,27H,7,12,17-21H2,1H3,(H,31,35)/t27-/m0/s1 |
| InChIKey | WXFQRBGMRJUAJY-MHZLTWQESA-N |
| XLogP | 3.70 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |