C28H34N4O3 — CID 93062036
4-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-(3-piperidin-1-ylpropyl)benzamide (PubChem CID 93062036) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 4-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-(3-piperidin-1-ylpropyl)benzamide.
| Compound Name | 4-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-(3-piperidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 93062036 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 4-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-(3-piperidin-1-ylpropyl)benzamide |
| SMILES | O=C(NCCCN1CCCCC1)c1ccc(CN2C(=O)[C@H]3CCCN3C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H34N4O3/c33-26(29-15-7-18-30-16-4-1-5-17-30)22-13-11-21(12-14-22)20-32-24-9-3-2-8-23(24)27(34)31-19-6-10-25(31)28(32)35/h2-3,8-9,11-14,25H,1,4-7,10,15-20H2,(H,29,33)/t25-/m1/s1 |
| InChIKey | RKXVUIDMCBMBAA-RUZDIDTESA-N |
| XLogP | 3.44 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|