C16H11ClN2O3 — CID 5304395
3-[(2-chlorophenyl)methyl]-4-oxophthalazine-1-carboxylic acid (PubChem CID 5304395) has the molecular formula C16H11ClN2O3 and a molecular weight of 314.73 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-4-oxophthalazine-1-carboxylic acid.
| Compound Name | 3-[(2-chlorophenyl)methyl]-4-oxophthalazine-1-carboxylic acid |
|---|---|
| PubChem CID | 5304395 |
| Molecular Formula | C16H11ClN2O3 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-4-oxophthalazine-1-carboxylic acid |
| SMILES | O=C(O)c1nn(Cc2ccccc2Cl)c(=O)c2ccccc12 |
| InChI | InChI=1S/C16H11ClN2O3/c17-13-8-4-1-5-10(13)9-19-15(20)12-7-3-2-6-11(12)14(18-19)16(21)22/h1-8H,9H2,(H,21,22) |
| InChIKey | YDUIFTSCBFPHCI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |