C25H26ClN5O2 — CID 16560074
N-[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-hexyl-4-oxophthalazine-1-carboxamide (PubChem CID 16560074) has the molecular formula C25H26ClN5O2 and a molecular weight of 463.97 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-hexyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-hexyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 16560074 |
| Molecular Formula | C25H26ClN5O2 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-hexyl-4-oxophthalazine-1-carboxamide |
| SMILES | CCCCCCn1nc(C(=O)Nc2ccnn2Cc2ccccc2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C25H26ClN5O2/c1-2-3-4-9-16-30-25(33)20-12-7-6-11-19(20)23(29-30)24(32)28-22-14-15-27-31(22)17-18-10-5-8-13-21(18)26/h5-8,10-15H,2-4,9,16-17H2,1H3,(H,28,32) |
| InChIKey | PJSBGBRLLKMNJJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|