C26H29N5O4 — CID 55434837
N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-4-oxo-3-pentylphthalazine-1-carboxamide (PubChem CID 55434837) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-4-oxo-3-pentylphthalazine-1-carboxamide.
| Compound Name | N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-4-oxo-3-pentylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55434837 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-4-oxo-3-pentylphthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)Nc2ccnn2Cc2cccc(OC)c2OC)c2ccccc2c1=O |
| InChI | InChI=1S/C26H29N5O4/c1-4-5-8-16-30-26(33)20-12-7-6-11-19(20)23(29-30)25(32)28-22-14-15-27-31(22)17-18-10-9-13-21(34-2)24(18)35-3/h6-7,9-15H,4-5,8,16-17H2,1-3H3,(H,28,32) |
| InChIKey | UZHUGVKLJPYKBK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|