C21H19N5O2S2 — CID 53046861
methyl 3-[[5-(3-aminothieno[2,3-b]pyridin-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate (PubChem CID 53046861) has the molecular formula C21H19N5O2S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is methyl 3-[[5-(3-aminothieno[2,3-b]pyridin-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate.
| Compound Name | methyl 3-[[5-(3-aminothieno[2,3-b]pyridin-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 53046861 |
| Molecular Formula | C21H19N5O2S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | methyl 3-[[5-(3-aminothieno[2,3-b]pyridin-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate |
| SMILES | C=CCn1c(SCc2cccc(C(=O)OC)c2)nnc1-c1sc2ncccc2c1N |
| InChI | InChI=1S/C21H19N5O2S2/c1-3-10-26-18(17-16(22)15-8-5-9-23-19(15)30-17)24-25-21(26)29-12-13-6-4-7-14(11-13)20(27)28-2/h3-9,11H,1,10,12,22H2,2H3 |
| InChIKey | WRAQRZJJBKJWEY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|