C24H21NO5S2 — CID 53047362
7-(3-methoxy-4-prop-2-ynoxyphenyl)-3-(4-methylphenyl)sulfonyl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 53047362) has the molecular formula C24H21NO5S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 7-(3-methoxy-4-prop-2-ynoxyphenyl)-3-(4-methylphenyl)sulfonyl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one.
| Compound Name | 7-(3-methoxy-4-prop-2-ynoxyphenyl)-3-(4-methylphenyl)sulfonyl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 53047362 |
| Molecular Formula | C24H21NO5S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 7-(3-methoxy-4-prop-2-ynoxyphenyl)-3-(4-methylphenyl)sulfonyl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | C#CCOc1ccc(C2CC(=O)Nc3c(S(=O)(=O)c4ccc(C)cc4)csc32)cc1OC |
| InChI | InChI=1S/C24H21NO5S2/c1-4-11-30-19-10-7-16(12-20(19)29-3)18-13-22(26)25-23-21(14-31-24(18)23)32(27,28)17-8-5-15(2)6-9-17/h1,5-10,12,14,18H,11,13H2,2-3H3,(H,25,26) |
| InChIKey | CUZYXRAWKKSRSH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|