C24H23NO5S2 — CID 95061765
(7S)-7-(4-methoxy-3-prop-2-enoxyphenyl)-3-(4-methylphenyl)sulfonyl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 95061765) has the molecular formula C24H23NO5S2 and a molecular weight of 469.58 g/mol. Its IUPAC name is (7S)-7-(4-methoxy-3-prop-2-enoxyphenyl)-3-(4-methylphenyl)sulfonyl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one.
| Compound Name | (7S)-7-(4-methoxy-3-prop-2-enoxyphenyl)-3-(4-methylphenyl)sulfonyl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 95061765 |
| Molecular Formula | C24H23NO5S2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | (7S)-7-(4-methoxy-3-prop-2-enoxyphenyl)-3-(4-methylphenyl)sulfonyl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | C=CCOc1cc([C@@H]2CC(=O)Nc3c(S(=O)(=O)c4ccc(C)cc4)csc32)ccc1OC |
| InChI | InChI=1S/C24H23NO5S2/c1-4-11-30-20-12-16(7-10-19(20)29-3)18-13-22(26)25-23-21(14-31-24(18)23)32(27,28)17-8-5-15(2)6-9-17/h4-10,12,14,18H,1,11,13H2,2-3H3,(H,25,26)/t18-/m0/s1 |
| InChIKey | PHBUPITZJGRKLB-SFHVURJKSA-N |
| XLogP | 4.94 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|