C24H21NO6S2 — CID 95061887
(7R)-3-(4-methoxyphenyl)sulfonyl-7-(3-methoxy-4-prop-2-ynoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 95061887) has the molecular formula C24H21NO6S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is (7R)-3-(4-methoxyphenyl)sulfonyl-7-(3-methoxy-4-prop-2-ynoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one.
| Compound Name | (7R)-3-(4-methoxyphenyl)sulfonyl-7-(3-methoxy-4-prop-2-ynoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 95061887 |
| Molecular Formula | C24H21NO6S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | (7R)-3-(4-methoxyphenyl)sulfonyl-7-(3-methoxy-4-prop-2-ynoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | C#CCOc1ccc([C@H]2CC(=O)Nc3c(S(=O)(=O)c4ccc(OC)cc4)csc32)cc1OC |
| InChI | InChI=1S/C24H21NO6S2/c1-4-11-31-19-10-5-15(12-20(19)30-3)18-13-22(26)25-23-21(14-32-24(18)23)33(27,28)17-8-6-16(29-2)7-9-17/h1,5-10,12,14,18H,11,13H2,2-3H3,(H,25,26)/t18-/m1/s1 |
| InChIKey | XPISUYYZTHIFED-GOSISDBHSA-N |
| XLogP | 4.08 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|