C26H23FN4O2 — CID 53052412
N-(4-fluorophenyl)-4-oxo-3-phenyl-2-piperidin-1-ylquinazoline-7-carboxamide (PubChem CID 53052412) has the molecular formula C26H23FN4O2 and a molecular weight of 442.49 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-oxo-3-phenyl-2-piperidin-1-ylquinazoline-7-carboxamide.
| Compound Name | N-(4-fluorophenyl)-4-oxo-3-phenyl-2-piperidin-1-ylquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 53052412 |
| Molecular Formula | C26H23FN4O2 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-(4-fluorophenyl)-4-oxo-3-phenyl-2-piperidin-1-ylquinazoline-7-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccc2c(=O)n(-c3ccccc3)c(N3CCCCC3)nc2c1 |
| InChI | InChI=1S/C26H23FN4O2/c27-19-10-12-20(13-11-19)28-24(32)18-9-14-22-23(17-18)29-26(30-15-5-2-6-16-30)31(25(22)33)21-7-3-1-4-8-21/h1,3-4,7-14,17H,2,5-6,15-16H2,(H,28,32) |
| InChIKey | JIKAXZXGBLCQKR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |