C23H29N3O3S — CID 53059167
N-cyclohexyl-5-[(3-methylphenyl)methylsulfamoyl]-2,3-dihydroindole-1-carboxamide (PubChem CID 53059167) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is N-cyclohexyl-5-[(3-methylphenyl)methylsulfamoyl]-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-cyclohexyl-5-[(3-methylphenyl)methylsulfamoyl]-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 53059167 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-cyclohexyl-5-[(3-methylphenyl)methylsulfamoyl]-2,3-dihydroindole-1-carboxamide |
| SMILES | Cc1cccc(CNS(=O)(=O)c2ccc3c(c2)CCN3C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C23H29N3O3S/c1-17-6-5-7-18(14-17)16-24-30(28,29)21-10-11-22-19(15-21)12-13-26(22)23(27)25-20-8-3-2-4-9-20/h5-7,10-11,14-15,20,24H,2-4,8-9,12-13,16H2,1H3,(H,25,27) |
| InChIKey | VQNRHWOGRFPLBC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |