C20H17ClN4O2S — CID 53063297
3-chloro-N-[2-(2-pyridin-4-ylbenzimidazol-1-yl)ethyl]benzenesulfonamide (PubChem CID 53063297) has the molecular formula C20H17ClN4O2S and a molecular weight of 412.90 g/mol. Its IUPAC name is 3-chloro-N-[2-(2-pyridin-4-ylbenzimidazol-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[2-(2-pyridin-4-ylbenzimidazol-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 53063297 |
| Molecular Formula | C20H17ClN4O2S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 3-chloro-N-[2-(2-pyridin-4-ylbenzimidazol-1-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCn1c(-c2ccncc2)nc2ccccc21)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H17ClN4O2S/c21-16-4-3-5-17(14-16)28(26,27)23-12-13-25-19-7-2-1-6-18(19)24-20(25)15-8-10-22-11-9-15/h1-11,14,23H,12-13H2 |
| InChIKey | UQBRFQXKCUZHQS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |