C17H11FN4O3 — CID 53065390
7-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]-4-methyl-1H-quinoxaline-2,3-dione (PubChem CID 53065390) has the molecular formula C17H11FN4O3 and a molecular weight of 338.30 g/mol. Its IUPAC name is 7-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]-4-methyl-1H-quinoxaline-2,3-dione.
| Compound Name | 7-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]-4-methyl-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 53065390 |
| Molecular Formula | C17H11FN4O3 |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 7-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]-4-methyl-1H-quinoxaline-2,3-dione |
| SMILES | Cn1c(=O)c(=O)[nH]c2cc(-c3noc(-c4cccc(F)c4)n3)ccc21 |
| InChI | InChI=1S/C17H11FN4O3/c1-22-13-6-5-9(8-12(13)19-15(23)17(22)24)14-20-16(25-21-14)10-3-2-4-11(18)7-10/h2-8H,1H3,(H,19,23) |
| InChIKey | AZNXCCMUEGSTPG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|