C19H15FN4O3 — CID 53065561
7-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]-4-propyl-1H-quinoxaline-2,3-dione (PubChem CID 53065561) has the molecular formula C19H15FN4O3 and a molecular weight of 366.35 g/mol. Its IUPAC name is 7-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]-4-propyl-1H-quinoxaline-2,3-dione.
| Compound Name | 7-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]-4-propyl-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 53065561 |
| Molecular Formula | C19H15FN4O3 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 7-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]-4-propyl-1H-quinoxaline-2,3-dione |
| SMILES | CCCn1c(=O)c(=O)[nH]c2cc(-c3noc(-c4ccc(F)cc4)n3)ccc21 |
| InChI | InChI=1S/C19H15FN4O3/c1-2-9-24-15-8-5-12(10-14(15)21-17(25)19(24)26)16-22-18(27-23-16)11-3-6-13(20)7-4-11/h3-8,10H,2,9H2,1H3,(H,21,25) |
| InChIKey | RMTBVGCNFLMRQF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|