C19H14N4O5 — CID 53005944
7-[5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-yl]-4-ethyl-1H-quinoxaline-2,3-dione (PubChem CID 53005944) has the molecular formula C19H14N4O5 and a molecular weight of 378.34 g/mol. Its IUPAC name is 7-[5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-yl]-4-ethyl-1H-quinoxaline-2,3-dione.
| Compound Name | 7-[5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-yl]-4-ethyl-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 53005944 |
| Molecular Formula | C19H14N4O5 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 7-[5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-yl]-4-ethyl-1H-quinoxaline-2,3-dione |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(-c3noc(-c4ccc5c(c4)OCO5)n3)ccc21 |
| InChI | InChI=1S/C19H14N4O5/c1-2-23-13-5-3-10(7-12(13)20-17(24)19(23)25)16-21-18(28-22-16)11-4-6-14-15(8-11)27-9-26-14/h3-8H,2,9H2,1H3,(H,20,24) |
| InChIKey | QTRREQBAXHUIGQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|