C21H18ClN5O4 — CID 53065405
2-(4-chlorophenyl)-N-[[3-(1-ethyl-2,3-dioxo-4H-quinoxalin-6-yl)-1,2,4-oxadiazol-5-yl]methyl]acetamide (PubChem CID 53065405) has the molecular formula C21H18ClN5O4 and a molecular weight of 439.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[[3-(1-ethyl-2,3-dioxo-4H-quinoxalin-6-yl)-1,2,4-oxadiazol-5-yl]methyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[[3-(1-ethyl-2,3-dioxo-4H-quinoxalin-6-yl)-1,2,4-oxadiazol-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 53065405 |
| Molecular Formula | C21H18ClN5O4 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[[3-(1-ethyl-2,3-dioxo-4H-quinoxalin-6-yl)-1,2,4-oxadiazol-5-yl]methyl]acetamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(-c3noc(CNC(=O)Cc4ccc(Cl)cc4)n3)ccc21 |
| InChI | InChI=1S/C21H18ClN5O4/c1-2-27-16-8-5-13(10-15(16)24-20(29)21(27)30)19-25-18(31-26-19)11-23-17(28)9-12-3-6-14(22)7-4-12/h3-8,10H,2,9,11H2,1H3,(H,23,28)(H,24,29) |
| InChIKey | UFSRLSFXQMFSRS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|