C22H21ClN4O4 — CID 53065648
7-[5-[(4-chloro-2-methylphenoxy)methyl]-1,2,4-oxadiazol-3-yl]-4-(2-methylpropyl)-1H-quinoxaline-2,3-dione (PubChem CID 53065648) has the molecular formula C22H21ClN4O4 and a molecular weight of 440.89 g/mol. Its IUPAC name is 7-[5-[(4-chloro-2-methylphenoxy)methyl]-1,2,4-oxadiazol-3-yl]-4-(2-methylpropyl)-1H-quinoxaline-2,3-dione.
| Compound Name | 7-[5-[(4-chloro-2-methylphenoxy)methyl]-1,2,4-oxadiazol-3-yl]-4-(2-methylpropyl)-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 53065648 |
| Molecular Formula | C22H21ClN4O4 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 7-[5-[(4-chloro-2-methylphenoxy)methyl]-1,2,4-oxadiazol-3-yl]-4-(2-methylpropyl)-1H-quinoxaline-2,3-dione |
| SMILES | Cc1cc(Cl)ccc1OCc1nc(-c2ccc3c(c2)[nH]c(=O)c(=O)n3CC(C)C)no1 |
| InChI | InChI=1S/C22H21ClN4O4/c1-12(2)10-27-17-6-4-14(9-16(17)24-21(28)22(27)29)20-25-19(31-26-20)11-30-18-7-5-15(23)8-13(18)3/h4-9,12H,10-11H2,1-3H3,(H,24,28) |
| InChIKey | KIMBRLGNXHYNLO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|