C20H18N4O3S — CID 53065658
4-(2-methylpropyl)-7-[5-[(E)-2-thiophen-2-ylethenyl]-1,2,4-oxadiazol-3-yl]-1H-quinoxaline-2,3-dione (PubChem CID 53065658) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is 4-(2-methylpropyl)-7-[5-[(E)-2-thiophen-2-ylethenyl]-1,2,4-oxadiazol-3-yl]-1H-quinoxaline-2,3-dione.
| Compound Name | 4-(2-methylpropyl)-7-[5-[(E)-2-thiophen-2-ylethenyl]-1,2,4-oxadiazol-3-yl]-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 53065658 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 4-(2-methylpropyl)-7-[5-[(E)-2-thiophen-2-ylethenyl]-1,2,4-oxadiazol-3-yl]-1H-quinoxaline-2,3-dione |
| SMILES | CC(C)Cn1c(=O)c(=O)[nH]c2cc(-c3noc(/C=C/c4cccs4)n3)ccc21 |
| InChI | InChI=1S/C20H18N4O3S/c1-12(2)11-24-16-7-5-13(10-15(16)21-19(25)20(24)26)18-22-17(27-23-18)8-6-14-4-3-9-28-14/h3-10,12H,11H2,1-2H3,(H,21,25)/b8-6+ |
| InChIKey | WEMAZWJZGSAEOF-SOFGYWHQSA-N |
| XLogP | 3.63 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|