C20H17ClN4O4 — CID 53065452
7-[5-[1-(3-chlorophenoxy)ethyl]-1,2,4-oxadiazol-3-yl]-4-ethyl-1H-quinoxaline-2,3-dione (PubChem CID 53065452) has the molecular formula C20H17ClN4O4 and a molecular weight of 412.83 g/mol. Its IUPAC name is 7-[5-[1-(3-chlorophenoxy)ethyl]-1,2,4-oxadiazol-3-yl]-4-ethyl-1H-quinoxaline-2,3-dione.
| Compound Name | 7-[5-[1-(3-chlorophenoxy)ethyl]-1,2,4-oxadiazol-3-yl]-4-ethyl-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 53065452 |
| Molecular Formula | C20H17ClN4O4 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 7-[5-[1-(3-chlorophenoxy)ethyl]-1,2,4-oxadiazol-3-yl]-4-ethyl-1H-quinoxaline-2,3-dione |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(-c3noc(C(C)Oc4cccc(Cl)c4)n3)ccc21 |
| InChI | InChI=1S/C20H17ClN4O4/c1-3-25-16-8-7-12(9-15(16)22-18(26)20(25)27)17-23-19(29-24-17)11(2)28-14-6-4-5-13(21)10-14/h4-11H,3H2,1-2H3,(H,22,26) |
| InChIKey | BEYCFOIIZKATCH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|