C19H17N5O5 — CID 53065465
N-[[3-(2,3-dioxo-1-propan-2-yl-4H-quinoxalin-6-yl)-1,2,4-oxadiazol-5-yl]methyl]furan-2-carboxamide (PubChem CID 53065465) has the molecular formula C19H17N5O5 and a molecular weight of 395.38 g/mol. Its IUPAC name is N-[[3-(2,3-dioxo-1-propan-2-yl-4H-quinoxalin-6-yl)-1,2,4-oxadiazol-5-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[3-(2,3-dioxo-1-propan-2-yl-4H-quinoxalin-6-yl)-1,2,4-oxadiazol-5-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 53065465 |
| Molecular Formula | C19H17N5O5 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[[3-(2,3-dioxo-1-propan-2-yl-4H-quinoxalin-6-yl)-1,2,4-oxadiazol-5-yl]methyl]furan-2-carboxamide |
| SMILES | CC(C)n1c(=O)c(=O)[nH]c2cc(-c3noc(CNC(=O)c4ccco4)n3)ccc21 |
| InChI | InChI=1S/C19H17N5O5/c1-10(2)24-13-6-5-11(8-12(13)21-18(26)19(24)27)16-22-15(29-23-16)9-20-17(25)14-4-3-7-28-14/h3-8,10H,9H2,1-2H3,(H,20,25)(H,21,26) |
| InChIKey | VVNBVKSZSYHKPL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|