C21H20N4O5 — CID 53065487
7-[5-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]-4-propan-2-yl-1H-quinoxaline-2,3-dione (PubChem CID 53065487) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is 7-[5-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]-4-propan-2-yl-1H-quinoxaline-2,3-dione.
| Compound Name | 7-[5-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]-4-propan-2-yl-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 53065487 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 7-[5-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]-4-propan-2-yl-1H-quinoxaline-2,3-dione |
| SMILES | COc1cccc(-c2nc(-c3ccc4c(c3)[nH]c(=O)c(=O)n4C(C)C)no2)c1OC |
| InChI | InChI=1S/C21H20N4O5/c1-11(2)25-15-9-8-12(10-14(15)22-19(26)21(25)27)18-23-20(30-24-18)13-6-5-7-16(28-3)17(13)29-4/h5-11H,1-4H3,(H,22,26) |
| InChIKey | KXHCVERWQGHZKB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|