C21H29NO5S — CID 5306889
N-[2-(1-adamantyloxy)propyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 5306889) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is N-[2-(1-adamantyloxy)propyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[2-(1-adamantyloxy)propyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 5306889 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[2-(1-adamantyloxy)propyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | CC(CNS(=O)(=O)c1ccc2c(c1)OCCO2)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H29NO5S/c1-14(27-21-10-15-6-16(11-21)8-17(7-15)12-21)13-22-28(23,24)18-2-3-19-20(9-18)26-5-4-25-19/h2-3,9,14-17,22H,4-8,10-13H2,1H3 |
| InChIKey | AROJSAAHODRHBN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |