C22H32N4O2 — CID 5307163
1-(1,3-benzoxazol-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide (PubChem CID 5307163) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 5307163 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide |
| SMILES | CC1CCCCN1CCCNC(=O)C1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C22H32N4O2/c1-17-7-4-5-13-25(17)14-6-12-23-21(27)18-10-15-26(16-11-18)22-24-19-8-2-3-9-20(19)28-22/h2-3,8-9,17-18H,4-7,10-16H2,1H3,(H,23,27) |
| InChIKey | TXPRAYUMWAWZGV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|