C19H22N4O — CID 53071781
N-(2,3-dimethylphenyl)-4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazine-1-carboxamide (PubChem CID 53071781) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazine-1-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazine-1-carboxamide |
|---|---|
| PubChem CID | 53071781 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-(2,3-dimethylphenyl)-4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazine-1-carboxamide |
| SMILES | C=CCN1CCN(C(=O)Nc2cccc(C)c2C)c2cccnc21 |
| InChI | InChI=1S/C19H22N4O/c1-4-11-22-12-13-23(17-9-6-10-20-18(17)22)19(24)21-16-8-5-7-14(2)15(16)3/h4-10H,1,11-13H2,2-3H3,(H,21,24) |
| InChIKey | PQUPTUGMYXERON-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|