C19H22N4O3 — CID 53071786
N-(3,4-dimethoxyphenyl)-4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazine-1-carboxamide (PubChem CID 53071786) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazine-1-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazine-1-carboxamide |
|---|---|
| PubChem CID | 53071786 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazine-1-carboxamide |
| SMILES | C=CCN1CCN(C(=O)Nc2ccc(OC)c(OC)c2)c2cccnc21 |
| InChI | InChI=1S/C19H22N4O3/c1-4-10-22-11-12-23(15-6-5-9-20-18(15)22)19(24)21-14-7-8-16(25-2)17(13-14)26-3/h4-9,13H,1,10-12H2,2-3H3,(H,21,24) |
| InChIKey | QVTPHRGUYCZNDZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|