C21H27N3O5S — CID 5307299
N-(2,5-diethoxyphenyl)-1-pyridin-3-ylsulfonylpiperidine-3-carboxamide (PubChem CID 5307299) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-1-pyridin-3-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2,5-diethoxyphenyl)-1-pyridin-3-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 5307299 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-1-pyridin-3-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)C2CCCN(S(=O)(=O)c3cccnc3)C2)c1 |
| InChI | InChI=1S/C21H27N3O5S/c1-3-28-17-9-10-20(29-4-2)19(13-17)23-21(25)16-7-6-12-24(15-16)30(26,27)18-8-5-11-22-14-18/h5,8-11,13-14,16H,3-4,6-7,12,15H2,1-2H3,(H,23,25) |
| InChIKey | CUZPMTJYXQABDK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |