C15H16ClN3O3S2 — CID 53076904
3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonylthiophene-2-carboxamide (PubChem CID 53076904) has the molecular formula C15H16ClN3O3S2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonylthiophene-2-carboxamide.
| Compound Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 53076904 |
| Molecular Formula | C15H16ClN3O3S2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonylthiophene-2-carboxamide |
| SMILES | NC(=O)c1sccc1S(=O)(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H16ClN3O3S2/c16-11-2-1-3-12(10-11)18-5-7-19(8-6-18)24(21,22)13-4-9-23-14(13)15(17)20/h1-4,9-10H,5-8H2,(H2,17,20) |
| InChIKey | QDKDIFKJBKHNTH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |