C25H37N5O — CID 5307927
N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-2-(5-methyl-4,5,6,7-tetrahydroindazol-2-yl)acetamide (PubChem CID 5307927) has the molecular formula C25H37N5O and a molecular weight of 423.61 g/mol. Its IUPAC name is N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-2-(5-methyl-4,5,6,7-tetrahydroindazol-2-yl)acetamide.
| Compound Name | N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-2-(5-methyl-4,5,6,7-tetrahydroindazol-2-yl)acetamide |
|---|---|
| PubChem CID | 5307927 |
| Molecular Formula | C25H37N5O |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-2-(5-methyl-4,5,6,7-tetrahydroindazol-2-yl)acetamide |
| SMILES | Cc1ccc(C)c(N2CCN(CCCNC(=O)Cn3cc4c(n3)CCC(C)C4)CC2)c1 |
| InChI | InChI=1S/C25H37N5O/c1-19-6-8-23-22(15-19)17-30(27-23)18-25(31)26-9-4-10-28-11-13-29(14-12-28)24-16-20(2)5-7-21(24)3/h5,7,16-17,19H,4,6,8-15,18H2,1-3H3,(H,26,31) |
| InChIKey | KMCFWEITYMYGNM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|