C23H32ClN5O — CID 20892341
N-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide (PubChem CID 20892341) has the molecular formula C23H32ClN5O and a molecular weight of 430.00 g/mol. Its IUPAC name is N-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide.
| Compound Name | N-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide |
|---|---|
| PubChem CID | 20892341 |
| Molecular Formula | C23H32ClN5O |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | N-[3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide |
| SMILES | Cc1ccc(Cl)cc1N1CCN(CCCNC(=O)Cn2cc3c(n2)CCCC3)CC1 |
| InChI | InChI=1S/C23H32ClN5O/c1-18-7-8-20(24)15-22(18)28-13-11-27(12-14-28)10-4-9-25-23(30)17-29-16-19-5-2-3-6-21(19)26-29/h7-8,15-16H,2-6,9-14,17H2,1H3,(H,25,30) |
| InChIKey | JJRYANNKHOTZNG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|