C26H29ClN4O2 — CID 20889265
2-(2-benzoylpyrrol-1-yl)-N-[2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]ethyl]acetamide (PubChem CID 20889265) has the molecular formula C26H29ClN4O2 and a molecular weight of 465.00 g/mol. Its IUPAC name is 2-(2-benzoylpyrrol-1-yl)-N-[2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]ethyl]acetamide.
| Compound Name | 2-(2-benzoylpyrrol-1-yl)-N-[2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 20889265 |
| Molecular Formula | C26H29ClN4O2 |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-(2-benzoylpyrrol-1-yl)-N-[2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]ethyl]acetamide |
| SMILES | Cc1ccc(Cl)cc1N1CCN(CCNC(=O)Cn2cccc2C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H29ClN4O2/c1-20-9-10-22(27)18-24(20)30-16-14-29(15-17-30)13-11-28-25(32)19-31-12-5-8-23(31)26(33)21-6-3-2-4-7-21/h2-10,12,18H,11,13-17,19H2,1H3,(H,28,32) |
| InChIKey | QYFJEFQPUWNODE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |