C20H22ClN3O3 — CID 53079738
4-(3-chloro-4-methylanilino)-N-(3-ethoxypropyl)furo[3,2-c]pyridine-6-carboxamide (PubChem CID 53079738) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is 4-(3-chloro-4-methylanilino)-N-(3-ethoxypropyl)furo[3,2-c]pyridine-6-carboxamide.
| Compound Name | 4-(3-chloro-4-methylanilino)-N-(3-ethoxypropyl)furo[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 53079738 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-(3-chloro-4-methylanilino)-N-(3-ethoxypropyl)furo[3,2-c]pyridine-6-carboxamide |
| SMILES | CCOCCCNC(=O)c1cc2occc2c(Nc2ccc(C)c(Cl)c2)n1 |
| InChI | InChI=1S/C20H22ClN3O3/c1-3-26-9-4-8-22-20(25)17-12-18-15(7-10-27-18)19(24-17)23-14-6-5-13(2)16(21)11-14/h5-7,10-12H,3-4,8-9H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | HWWRDJGTOPUSTL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|