C15H15N3O2S2 — CID 53083829
N-(3,5-dimethylphenyl)-5-(1H-pyrazol-5-yl)thiophene-2-sulfonamide (PubChem CID 53083829) has the molecular formula C15H15N3O2S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-5-(1H-pyrazol-5-yl)thiophene-2-sulfonamide.
| Compound Name | N-(3,5-dimethylphenyl)-5-(1H-pyrazol-5-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53083829 |
| Molecular Formula | C15H15N3O2S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N-(3,5-dimethylphenyl)-5-(1H-pyrazol-5-yl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc(-c3ccn[nH]3)s2)c1 |
| InChI | InChI=1S/C15H15N3O2S2/c1-10-7-11(2)9-12(8-10)18-22(19,20)15-4-3-14(21-15)13-5-6-16-17-13/h3-9,18H,1-2H3,(H,16,17) |
| InChIKey | UFFCNCRDCGZREO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |