C21H25N5O2 — CID 53088354
2-methyl-8-oxo-N-(4-phenylbutan-2-yl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide (PubChem CID 53088354) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-methyl-8-oxo-N-(4-phenylbutan-2-yl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide.
| Compound Name | 2-methyl-8-oxo-N-(4-phenylbutan-2-yl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 53088354 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2-methyl-8-oxo-N-(4-phenylbutan-2-yl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-triene-4-carboxamide |
| SMILES | CC(CCc1ccccc1)NC(=O)c1cnn2c(=O)c3c(n(C)c12)CCNC3 |
| InChI | InChI=1S/C21H25N5O2/c1-14(8-9-15-6-4-3-5-7-15)24-19(27)17-13-23-26-20(17)25(2)18-10-11-22-12-16(18)21(26)28/h3-7,13-14,22H,8-12H2,1-2H3,(H,24,27) |
| InChIKey | GYGGTUXUJWYRTO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |