C26H24N4O3S — CID 53091519
N-[2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]-1,2-benzothiazole-3-carboxamide (PubChem CID 53091519) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is N-[2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]-1,2-benzothiazole-3-carboxamide.
| Compound Name | N-[2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]-1,2-benzothiazole-3-carboxamide |
|---|---|
| PubChem CID | 53091519 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-[2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]-1,2-benzothiazole-3-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccccc3NC(=O)c3nsc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C26H24N4O3S/c1-33-19-12-10-18(11-13-19)29-14-16-30(17-15-29)26(32)20-6-2-4-8-22(20)27-25(31)24-21-7-3-5-9-23(21)34-28-24/h2-13H,14-17H2,1H3,(H,27,31) |
| InChIKey | NIIPWJRINUKTIN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|