C24H25N3O3S — CID 55982546
N-[2-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]phenyl]thiophene-3-carboxamide (PubChem CID 55982546) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-[2-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]phenyl]thiophene-3-carboxamide.
| Compound Name | N-[2-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 55982546 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[2-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]phenyl]thiophene-3-carboxamide |
| SMILES | COc1ccc(N2CCCN(C(=O)c3ccccc3NC(=O)c3ccsc3)CC2)cc1 |
| InChI | InChI=1S/C24H25N3O3S/c1-30-20-9-7-19(8-10-20)26-12-4-13-27(15-14-26)24(29)21-5-2-3-6-22(21)25-23(28)18-11-16-31-17-18/h2-3,5-11,16-17H,4,12-15H2,1H3,(H,25,28) |
| InChIKey | AOANWCXQPJKNDC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|