C14H14N2O4 — CID 5309272
[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]-morpholin-4-ylmethanone (PubChem CID 5309272) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is [5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 5309272 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | [5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cc(-c2cccc(O)c2)on1)N1CCOCC1 |
| InChI | InChI=1S/C14H14N2O4/c17-11-3-1-2-10(8-11)13-9-12(15-20-13)14(18)16-4-6-19-7-5-16/h1-3,8-9,17H,4-7H2 |
| InChIKey | URNBEXARQZDFKS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |